ChemNet > CAS > 2980-33-8 2-Hydroxy-3,5-dinitropyridine
2980-33-8 2-Hydroxy-3,5-dinitropyridine
| Ονομασία του προϊόντος |
2-Hydroxy-3,5-dinitropyridine |
| Αγγλικό όνομα |
2-Hydroxy-3,5-dinitropyridine; 3,5-Dinitro-2-pyridinol; 3,5-Dinitro-2-hydroxypyridine; 3,5-dinitropyridin-2(1H)-one; 5-nitro-6-oxo-1,6-dihydropyridine-3-carboxylic acid |
| MF |
C6H4N2O5 |
| Μοριακό βάρος |
184.1064 |
| InChI |
InChI=1/C6H4N2O5/c9-5-4(8(12)13)1-3(2-7-5)6(10)11/h1-2H,(H,7,9)(H,10,11) |
| CAS ΟΧΙ |
2980-33-8 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.7g/cm3 |
| Σημείο βρασμού |
363.6°C at 760 mmHg |
| Δείκτης διάθλασης |
1.634 |
| Σημείο ανάφλεξης |
173.7°C |
| Πίεση ατμών |
2.82E-06mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
