30273-11-1 4-sec-Butylaniline
Ονομασία του προϊόντος |
4-sec-Butylaniline |
Αγγλικό όνομα |
4-sec-Butylaniline; benzenamine, 4-(1-methylpropyl)-; p-sec-Butylaniline; 4-(butan-2-yl)aniline; N-(1-methylpropyl)-benzenamine |
MF |
C10H15N |
Μοριακό βάρος |
149.2328 |
InChI |
InChI=1/C10H15N/c1-3-8(2)9-4-6-10(11)7-5-9/h4-8H,3,11H2,1-2H3 |
CAS ΟΧΙ |
30273-11-1 |
EINECS |
250-108-9 |
Μοριακή δομή |
|
Πυκνότητα |
0.942g/cm3 |
Σημείο βρασμού |
244.2°C at 760 mmHg |
Δείκτης διάθλασης |
1.535 |
Σημείο ανάφλεξης |
107.8°C |
Πίεση ατμών |
0.0308mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|