ChemNet > CAS > 31909-58-7 2-Furoylacetonitrile
31909-58-7 2-Furoylacetonitrile
| Ονομασία του προϊόντος |
2-Furoylacetonitrile |
| Αγγλικό όνομα |
2-Furoylacetonitrile;3-(furan-2-yl)-3-oxopropanenitrile |
| MF |
C7H5NO2 |
| Μοριακό βάρος |
135.1201 |
| InChI |
InChI=1/C7H5NO2/c8-4-3-6(9)7-2-1-5-10-7/h1-2,5H,3H2 |
| CAS ΟΧΙ |
31909-58-7 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.188g/cm3 |
| Σημείο τήξης |
76-83℃ |
| Σημείο βρασμού |
297.2°C at 760 mmHg |
| Δείκτης διάθλασης |
1.494 |
| Σημείο ανάφλεξης |
133.6°C |
| Πίεση ατμών |
0.00137mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
 Xn:Harmful;
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S36/37:Wear suitable protective clothing and gloves.;
|
|
