320-65-0 2-fluorobenzal chloride

Ονομασία του προϊόντος	2-fluorobenzal chloride
Αγγλικό όνομα	2-fluorobenzal chloride; alpha,alpha-Dichloro-2-fluorotoluene
MF	C₇H₅Cl₂F
Μοριακό βάρος	179.02
InChI	InChI=1/C7H5Cl2F/c8-7(9)5-3-1-2-4-6(5)10/h1-4,7H
CAS ΟΧΙ	320-65-0
EINECS	206-279-7
Μοριακή δομή
Πυκνότητα	1.3
Σημείο βρασμού	224℃
Σύμβολα επικινδυνότητας
Κινδύνου Κώδικες	R34:Causes burns.; R36:Irritating to eyes.;
Περιγραφή της ασφάλειας	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;