32556-70-0 (R)-1-Octyn-3-ol
Ονομασία του προϊόντος |
(R)-1-Octyn-3-ol |
Αγγλικό όνομα |
(R)-1-Octyn-3-ol; (R)-(+)-1-Octyn-3-ol; (3R)-oct-1-yn-3-ol |
MF |
C8H14O |
Μοριακό βάρος |
126.1962 |
InChI |
InChI=1/C8H14O/c1-3-5-6-7-8(9)4-2/h2,8-9H,3,5-7H2,1H3/t8-/m0/s1 |
CAS ΟΧΙ |
32556-70-0 |
Μοριακή δομή |
|
Πυκνότητα |
0.887g/cm3 |
Σημείο βρασμού |
169.6°C at 760 mmHg |
Δείκτης διάθλασης |
1.452 |
Σημείο ανάφλεξης |
63.9°C |
Πίεση ατμών |
0.496mmHg at 25°C |
Σύμβολα επικινδυνότητας |
Xi:Irritant;
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|