3319-99-1 2-(2-thienyl)pyridine
Ονομασία του προϊόντος |
2-(2-thienyl)pyridine |
Αγγλικό όνομα |
2-(2-thienyl)pyridine; 2-(2-Pyridyl)thiophene; 2-(thiophen-2-yl)pyridine |
MF |
C9H7NS |
Μοριακό βάρος |
161.2236 |
InChI |
InChI=1/C9H7NS/c1-2-6-10-8(4-1)9-5-3-7-11-9/h1-7H |
CAS ΟΧΙ |
3319-99-1 |
EINECS |
222-022-1 |
Μοριακή δομή |
|
Πυκνότητα |
1.173g/cm3 |
Σημείο βρασμού |
268°C at 760 mmHg |
Δείκτης διάθλασης |
1.604 |
Σημείο ανάφλεξης |
115°C |
Πίεση ατμών |
0.013mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|