ChemNet > CAS > 3321-92-4 3',5'-dichloro-2'-hydroxyacetophenone
3321-92-4 3',5'-dichloro-2'-hydroxyacetophenone
Ονομασία του προϊόντος |
3',5'-dichloro-2'-hydroxyacetophenone |
Αγγλικό όνομα |
3',5'-dichloro-2'-hydroxyacetophenone; 3,5-Dichloro-2-hydroxyacetophenone; 1-(3,5-dichloro-2-hydroxyphenyl)ethanone |
MF |
C8H6Cl2O2 |
Μοριακό βάρος |
205.038 |
InChI |
InChI=1/C8H6Cl2O2/c1-4(11)6-2-5(9)3-7(10)8(6)12/h2-3,12H,1H3 |
CAS ΟΧΙ |
3321-92-4 |
Μοριακή δομή |
|
Πυκνότητα |
1.43g/cm3 |
Σημείο τήξης |
94-97℃ |
Σημείο βρασμού |
295.6°C at 760 mmHg |
Δείκτης διάθλασης |
1.583 |
Σημείο ανάφλεξης |
132.6°C |
Πίεση ατμών |
0.000856mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|