344-14-9 dimethyl fluoromalonate
Ονομασία του προϊόντος |
dimethyl fluoromalonate |
Αγγλικό όνομα |
dimethyl fluoromalonate; Fluoromalonic acid dimethyl ester; dimethyl fluoropropanedioate; 2-Fluoro-malonic acid dimethyl ester |
MF |
C5H7FO4 |
Μοριακό βάρος |
150.1051 |
InChI |
InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
CAS ΟΧΙ |
344-14-9 |
Μοριακή δομή |
|
Πυκνότητα |
1.211g/cm3 |
Σημείο βρασμού |
140.3°C at 760 mmHg |
Δείκτης διάθλασης |
1.382 |
Σημείο ανάφλεξης |
38.4°C |
Πίεση ατμών |
6.18mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R34:Causes burns.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|