347-63-7 3-(3-Fluoro-4-methoxybenzoyl)propionic acid

Ονομασία του προϊόντος	3-(3-Fluoro-4-methoxybenzoyl)propionic acid
Αγγλικό όνομα	3-(3-Fluoro-4-methoxybenzoyl)propionic acid;
MF	C₁₁H₁₁FO₄
Μοριακό βάρος	226.20
InChI	InChI=1/C11H11FO4/c1-16-10-4-2-7(6-8(10)12)9(13)3-5-11(14)15/h2,4,6H,3,5H2,1H3,(H,14,15)
CAS ΟΧΙ	347-63-7
EINECS	206-474-7
Μοριακή δομή
Σύμβολα επικινδυνότητας
Κινδύνου Κώδικες	R36/37/38:Irritating to eyes, respiratory system and skin.;
Περιγραφή της ασφάλειας	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;