35354-37-1 1-Bromo-5-methylhexane
Ονομασία του προϊόντος |
1-Bromo-5-methylhexane |
Αγγλικό όνομα |
1-Bromo-5-methylhexane; |
MF |
C7H15Br |
Μοριακό βάρος |
179.098 |
InChI |
InChI=1/C7H15Br/c1-7(2)5-3-4-6-8/h7H,3-6H2,1-2H3 |
CAS ΟΧΙ |
35354-37-1 |
Μοριακή δομή |
|
Πυκνότητα |
1.136g/cm3 |
Σημείο βρασμού |
168°C at 760 mmHg |
Δείκτης διάθλασης |
1.447 |
Σημείο ανάφλεξης |
48.4°C |
Πίεση ατμών |
2.18mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|