ChemNet > CAS > 35884-42-5 di(propylene glycol) butyl ether, mixture of
35884-42-5 di(propylene glycol) butyl ether, mixture of
Ονομασία του προϊόντος |
di(propylene glycol) butyl ether, mixture of |
Αγγλικό όνομα |
di(propylene glycol) butyl ether, mixture of; Di(propylene glycol) butyl ether,mixture of isomers; 1-(3-butoxypropoxy)propan-1-ol; Dipropylene glycol butyl ether |
MF |
C10H22O3 |
Μοριακό βάρος |
190.2799 |
InChI |
InChI=1/C10H22O3/c1-3-5-7-12-8-6-9-13-10(11)4-2/h10-11H,3-9H2,1-2H3 |
CAS ΟΧΙ |
35884-42-5 |
EINECS |
252-776-7 |
Μοριακή δομή |
|
Πυκνότητα |
0.931g/cm3 |
Σημείο βρασμού |
221.1°C at 760 mmHg |
Δείκτης διάθλασης |
1.435 |
Σημείο ανάφλεξης |
87.5°C |
Πίεση ατμών |
0.0226mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
|
|