ChemNet > CAS > 3715-29-5 3-Methyl-2-oxobutanoic acid, sodium salt
3715-29-5 3-Methyl-2-oxobutanoic acid, sodium salt
Ονομασία του προϊόντος |
3-Methyl-2-oxobutanoic acid, sodium salt |
Αγγλικό όνομα |
3-Methyl-2-oxobutanoic acid, sodium salt; 3-methyl-2-oxobutyric acid sodium salt; A-ketoisovaleric acid sodium; sodium 3-methyl-2-oxobutanoate; Sodium 3-methyl-2-oxobutyrate; 3-Methyl-2-oxobutanoic acid sodium salt; 3-methyl-2-oxobutanoic acid; 3-methyl-2-oxobutanoate |
MF |
C5H7O3 |
Μοριακό βάρος |
115.1078 |
InChI |
InChI=1/C5H8O3/c1-3(2)4(6)5(7)8/h3H,1-2H3,(H,7,8)/p-1 |
CAS ΟΧΙ |
3715-29-5 |
EINECS |
223-062-2 |
Μοριακή δομή |
|
Σημείο τήξης |
227-230℃ (dec.) |
Σημείο βρασμού |
170.2°C at 760 mmHg |
Σημείο ανάφλεξης |
71°C |
Πίεση ατμών |
0.732mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|