ChemNet > CAS > 374538-01-9 4-Fluoro-3-formylbenzeneboronic acid
374538-01-9 4-Fluoro-3-formylbenzeneboronic acid
Ονομασία του προϊόντος |
4-Fluoro-3-formylbenzeneboronic acid |
Αγγλικό όνομα |
4-Fluoro-3-formylbenzeneboronic acid; 5-Borono-2-fluorobenzaldehyde; 4-Fluoro-3-formylphenylboronic acid; (4-fluoro-3-formylphenyl)boronic acid |
MF |
C7H6BFO3 |
Μοριακό βάρος |
167.9301 |
InChI |
InChI=1/C7H6BFO3/c9-7-2-1-6(8(11)12)3-5(7)4-10/h1-4,11-12H |
CAS ΟΧΙ |
374538-01-9 |
Μοριακή δομή |
|
Πυκνότητα |
1.33g/cm3 |
Σημείο βρασμού |
342.9°C at 760 mmHg |
Δείκτης διάθλασης |
1.524 |
Σημείο ανάφλεξης |
161.2°C |
Πίεση ατμών |
2.8E-05mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|