ChemNet > CAS > 374538-04-2 4-Cyclohexylbenzeneboronic acid
374538-04-2 4-Cyclohexylbenzeneboronic acid
| Ονομασία του προϊόντος |
4-Cyclohexylbenzeneboronic acid |
| Αγγλικό όνομα |
4-Cyclohexylbenzeneboronic acid; 4-Cyclohexylphenylboronic acid |
| MF |
C12H17BO2 |
| Μοριακό βάρος |
204.0732 |
| InChI |
InChI=1/C12H17BO2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h6-10,14-15H,1-5H2 |
| CAS ΟΧΙ |
374538-04-2 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.09g/cm3 |
| Σημείο βρασμού |
363.7°C at 760 mmHg |
| Δείκτης διάθλασης |
1.543 |
| Σημείο ανάφλεξης |
173.8°C |
| Πίεση ατμών |
6.29E-06mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
