ChemNet > CAS > 37526-88-8 Benzyl tiglate
37526-88-8 Benzyl tiglate
| Ονομασία του προϊόντος |
Benzyl tiglate |
| Αγγλικό όνομα |
Benzyl tiglate; Tiglic acid benzyl ester; Benzyl trans-2,3-dimethylacrylate~Benzyl (E)-2-methyl-2-butenoate~Tiglic acid benzyl ester; benzyl 2-methylbut-2-enoate; benzyl (2E)-2-methylbut-2-enoate |
| MF |
C12H14O2 |
| Μοριακό βάρος |
190.2384 |
| InChI |
InChI=1/C12H14O2/c1-3-10(2)12(13)14-9-11-7-5-4-6-8-11/h3-8H,9H2,1-2H3/b10-3+ |
| CAS ΟΧΙ |
37526-88-8 |
| EINECS |
253-544-8 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.027g/cm3 |
| Σημείο βρασμού |
267.7°C at 760 mmHg |
| Δείκτης διάθλασης |
1.516 |
| Σημείο ανάφλεξης |
135.9°C |
| Πίεση ατμών |
0.00802mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/38:Irritating to eyes and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
