ChemNet > CAS > 37887-04-0;54812-86-1 (R*,S*)-3-Mercaptobutan-2-ol
37887-04-0;54812-86-1 (R*,S*)-3-Mercaptobutan-2-ol
| Ονομασία του προϊόντος |
(R*,S*)-3-Mercaptobutan-2-ol |
| Αγγλικό όνομα |
(R*,S*)-3-Mercaptobutan-2-ol; 2-Butanol, 3-mercapto-,(2R,3S)-rel-; 2-Butanol,3-mercapto-, (R*,S*)-; 3-Mercapto-2-butanol; 2-Butanol, 3-mercapto-, (theta,S)-; 2-Mercapto-3-Butanol; 3-Mercapto-2-butanol,mixture of isomers; 3-mercapto-2-butanol, mixture of isomers; 3-mercaptobutan-2-ol; 3-Sulfanylbutan-2-ol |
| MF |
C4H10OS |
| Μοριακό βάρος |
106.1866 |
| InChI |
InChI=1/C4H10OS/c1-3(5)4(2)6/h3-6H,1-2H3 |
| CAS ΟΧΙ |
37887-04-0;54812-86-1 |
| EINECS |
253-701-0 |
| Μοριακή δομή |
|
| Πυκνότητα |
0.993g/cm3 |
| Σημείο βρασμού |
162.3°C at 760 mmHg |
| Δείκτης διάθλασης |
1.472 |
| Σημείο ανάφλεξης |
61.7°C |
| Πίεση ατμών |
0.75mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
|
|
