ChemNet > CAS > 37902-58-2 4-Oxo-4-phenylamino-2-butenoic acid
37902-58-2 4-Oxo-4-phenylamino-2-butenoic acid
| Ονομασία του προϊόντος |
4-Oxo-4-phenylamino-2-butenoic acid |
| Αγγλικό όνομα |
4-Oxo-4-phenylamino-2-butenoic acid;4-Oxo-4-(phenylamino)-2-butenoic acid; 4-oxo-4-(phenylamino)but-2-enoic acid; (2E)-4-oxo-4-(phenylamino)but-2-enoic acid; (2E)-4-oxo-4-(phenylamino)but-2-enoate |
| MF |
C10H8NO3 |
| Μοριακό βάρος |
190.176 |
| InChI |
InChI=1/C10H9NO3/c12-9(6-7-10(13)14)11-8-4-2-1-3-5-8/h1-7H,(H,11,12)(H,13,14)/p-1/b7-6+ |
| CAS ΟΧΙ |
37902-58-2 |
| EINECS |
253-707-3 |
| Μοριακή δομή |
|
| Σημείο βρασμού |
442.1°C at 760 mmHg |
| Σημείο ανάφλεξης |
221.1°C |
| Πίεση ατμών |
1.36E-08mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
 Xi:Irritant;
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
|
|
