39905-44-7 p-Heptyloxyaniline
Ονομασία του προϊόντος |
p-Heptyloxyaniline |
Αγγλικό όνομα |
p-Heptyloxyaniline; 4-n-Heptyloxyaniline; 4-(heptyloxy)aniline |
MF |
C13H21NO |
Μοριακό βάρος |
207.3119 |
InChI |
InChI=1/C13H21NO/c1-2-3-4-5-6-11-15-13-9-7-12(14)8-10-13/h7-10H,2-6,11,14H2,1H3 |
CAS ΟΧΙ |
39905-44-7 |
Μοριακή δομή |
|
Πυκνότητα |
0.965g/cm3 |
Σημείο βρασμού |
325.9°C at 760 mmHg |
Δείκτης διάθλασης |
1.516 |
Σημείο ανάφλεξης |
145°C |
Πίεση ατμών |
0.000223mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|