ChemNet > CAS > 39943-56-1 3,5-Dichlorophenylhydrazine
39943-56-1 3,5-Dichlorophenylhydrazine
| Ονομασία του προϊόντος |
3,5-Dichlorophenylhydrazine |
| Αγγλικό όνομα |
3,5-Dichlorophenylhydrazine; |
| MF |
C6H6Cl2N2 |
| Μοριακό βάρος |
177.0312 |
| InChI |
InChI=1/C6H6Cl2N2/c7-4-1-5(8)3-6(2-4)10-9/h1-3,10H,9H2 |
| CAS ΟΧΙ |
39943-56-1 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.475g/cm3 |
| Σημείο βρασμού |
286.1°C at 760 mmHg |
| Δείκτης διάθλασης |
1.665 |
| Σημείο ανάφλεξης |
126.8°C |
| Πίεση ατμών |
0.0027mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
