ChemNet > CAS > 39974-94-2 5-Methoxy-1-methylindole-3-carboxaldehyde
39974-94-2 5-Methoxy-1-methylindole-3-carboxaldehyde
| Ονομασία του προϊόντος |
5-Methoxy-1-methylindole-3-carboxaldehyde |
| Αγγλικό όνομα |
5-Methoxy-1-methylindole-3-carboxaldehyde; 3-Formyl-5-methoxy-1-methylindole; 5-methoxy-1-methyl-1H-indole-3-carbaldehyde |
| MF |
C11H11NO2 |
| Μοριακό βάρος |
189.2105 |
| InChI |
InChI=1/C11H11NO2/c1-12-6-8(7-13)10-5-9(14-2)3-4-11(10)12/h3-7H,1-2H3 |
| CAS ΟΧΙ |
39974-94-2 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.14g/cm3 |
| Σημείο βρασμού |
357.9°C at 760 mmHg |
| Δείκτης διάθλασης |
1.565 |
| Σημείο ανάφλεξης |
170.2°C |
| Πίεση ατμών |
2.65E-05mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
