ChemNet > CAS > 40046-30-8 3,5-Dimethylisothiocyanatobenzene
40046-30-8 3,5-Dimethylisothiocyanatobenzene
| Ονομασία του προϊόντος |
3,5-Dimethylisothiocyanatobenzene |
| Αγγλικό όνομα |
3,5-Dimethylisothiocyanatobenzene; 3,5-Dimethylphenyl isothiocyanate; 1-isothiocyanato-3,5-dimethylbenzene |
| MF |
C9H9NS |
| Μοριακό βάρος |
163.2395 |
| InChI |
InChI=1/C9H9NS/c1-7-3-8(2)5-9(4-7)10-6-11/h3-5H,1-2H3 |
| CAS ΟΧΙ |
40046-30-8 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.01g/cm3 |
| Σημείο βρασμού |
282.2°C at 760 mmHg |
| Δείκτης διάθλασης |
1.554 |
| Σημείο ανάφλεξης |
127.3°C |
| Πίεση ατμών |
0.00582mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
 Xn:Harmful;
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
