ChemNet > CAS > 40400-15-5 2-Iodophenylacetonitrile
40400-15-5 2-Iodophenylacetonitrile
Ονομασία του προϊόντος |
2-Iodophenylacetonitrile |
Αγγλικό όνομα |
2-Iodophenylacetonitrile; 2-Iodobenzyl cyanide |
MF |
C8H6IN |
Μοριακό βάρος |
243.0444 |
InChI |
InChI=1/C8H6IN/c9-8-4-2-1-3-7(8)5-6-10/h1-4H,5H2 |
CAS ΟΧΙ |
40400-15-5 |
Μοριακή δομή |
|
Πυκνότητα |
1.764g/cm3 |
Σημείο βρασμού |
306°C at 760 mmHg |
Δείκτης διάθλασης |
1.624 |
Σημείο ανάφλεξης |
138.8°C |
Πίεση ατμών |
0.000795mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S36/37:Wear suitable protective clothing and gloves.;
|
|