ChemNet > CAS > 41825-73-4 2-Bromo-4,6-dimethylaniline
41825-73-4 2-Bromo-4,6-dimethylaniline
| Ονομασία του προϊόντος |
2-Bromo-4,6-dimethylaniline |
| Αγγλικό όνομα |
2-Bromo-4,6-dimethylaniline; Benzenamine, 2-bromo-4,6-dimethyl-; 2-Bromo-4,6-dimethylbenzenamine |
| MF |
C8H10BrN |
| Μοριακό βάρος |
200.0757 |
| InChI |
InChI=1/C8H10BrN/c1-5-3-6(2)8(10)7(9)4-5/h3-4H,10H2,1-2H3 |
| CAS ΟΧΙ |
41825-73-4 |
| EINECS |
246-337-9 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.424g/cm3 |
| Σημείο τήξης |
49-79℃ |
| Σημείο βρασμού |
260.9°C at 760 mmHg |
| Δείκτης διάθλασης |
1.596 |
| Σημείο ανάφλεξης |
111.6°C |
| Πίεση ατμών |
0.0119mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
