ChemNet > CAS > 41927-01-9 3,4-Dimethyl-o-phenylenediamine
41927-01-9 3,4-Dimethyl-o-phenylenediamine
Ονομασία του προϊόντος |
3,4-Dimethyl-o-phenylenediamine |
Αγγλικό όνομα |
3,4-Dimethyl-o-phenylenediamine; 3,4-Diamino-o-xylene = 3,4-Dimethylphenylenediamine; 3,4-dimethylbenzene-1,2-diamine |
MF |
C8H12N2 |
Μοριακό βάρος |
136.1943 |
InChI |
InChI=1/C8H12N2/c1-5-3-4-7(9)8(10)6(5)2/h3-4H,9-10H2,1-2H3 |
CAS ΟΧΙ |
41927-01-9 |
Μοριακή δομή |
|
Πυκνότητα |
1.076g/cm3 |
Σημείο βρασμού |
278.3°C at 760 mmHg |
Δείκτης διάθλασης |
1.618 |
Σημείο ανάφλεξης |
143.9°C |
Πίεση ατμών |
0.00431mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|