ChemNet > CAS > 42066-86-4 2-isocyanatobenzonitrile
42066-86-4 2-isocyanatobenzonitrile
| Ονομασία του προϊόντος |
2-isocyanatobenzonitrile |
| Αγγλικό όνομα |
2-isocyanatobenzonitrile; 2-Cyanophenyl isocyanate |
| MF |
C8H4N2O |
| Μοριακό βάρος |
144.1302 |
| InChI |
InChI=1/C8H4N2O/c9-5-7-3-1-2-4-8(7)10-6-11/h1-4H |
| CAS ΟΧΙ |
42066-86-4 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.09g/cm3 |
| Σημείο τήξης |
59℃ |
| Σημείο βρασμού |
266.2°C at 760 mmHg |
| Δείκτης διάθλασης |
1.562 |
| Σημείο ανάφλεξης |
114.8°C |
| Πίεση ατμών |
0.00875mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
 Xn:Harmful;
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
