ChemNet > CAS > 423768-53-0 ethyl 1-cyclopropyl-4-formyl-2,5-dimethyl-1H-pyrrole-3-carboxylate
423768-53-0 ethyl 1-cyclopropyl-4-formyl-2,5-dimethyl-1H-pyrrole-3-carboxylate
| Ονομασία του προϊόντος |
ethyl 1-cyclopropyl-4-formyl-2,5-dimethyl-1H-pyrrole-3-carboxylate |
| Αγγλικό όνομα |
ethyl 1-cyclopropyl-4-formyl-2,5-dimethyl-1H-pyrrole-3-carboxylate; |
| MF |
C13H17NO3 |
| Μοριακό βάρος |
235.279 |
| InChI |
InChI=1/C13H17NO3/c1-4-17-13(16)12-9(3)14(10-5-6-10)8(2)11(12)7-15/h7,10H,4-6H2,1-3H3 |
| CAS ΟΧΙ |
423768-53-0 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.21g/cm3 |
| Σημείο τήξης |
75℃ |
| Σημείο βρασμού |
391.9°C at 760 mmHg |
| Δείκτης διάθλασης |
1.571 |
| Σημείο ανάφλεξης |
190.8°C |
| Πίεση ατμών |
2.38E-06mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
 Xi:Irritant;
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
