44520-55-0 D(-)-Threoninol
Ονομασία του προϊόντος |
D(-)-Threoninol |
Αγγλικό όνομα |
D(-)-Threoninol; (2R,3R)-2-Amino-1,3-butanediol; D-Threoninol; (2R,3R)-1,3-dihydroxybutan-2-aminium; (2S,3S)-1,3-dihydroxybutan-2-aminium; (2S,3S)-2-aminobutane-1,3-diol |
MF |
C4H11NO2 |
Μοριακό βάρος |
105.1356 |
InChI |
InChI=1/C4H11NO2/c1-3(7)4(5)2-6/h3-4,6-7H,2,5H2,1H3/t3-,4-/m0/s1 |
CAS ΟΧΙ |
44520-55-0 |
Μοριακή δομή |
|
Πυκνότητα |
1.118g/cm3 |
Σημείο τήξης |
57.5-61.5℃ |
Σημείο βρασμού |
257.8°C at 760 mmHg |
Δείκτης διάθλασης |
1.488 |
Σημείο ανάφλεξης |
109.7°C |
Πίεση ατμών |
0.00212mmHg at 25°C |
Σύμβολα επικινδυνότητας |
Xi:Irritant;
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|