ChemNet > CAS > 4651-82-5 2-aminothiophene-3-carbonitrile
4651-82-5 2-aminothiophene-3-carbonitrile
Ονομασία του προϊόντος |
2-aminothiophene-3-carbonitrile |
Αγγλικό όνομα |
2-aminothiophene-3-carbonitrile; 2-Amino-3-cyanothiophene; 2-Amino-3-thiophenecarbonitrile |
MF |
C5H4N2S |
Μοριακό βάρος |
124.1637 |
InChI |
InChI=1/C5H4N2S/c6-3-4-1-2-8-5(4)7/h1-2H,7H2 |
CAS ΟΧΙ |
4651-82-5 |
Μοριακή δομή |
|
Πυκνότητα |
1.33g/cm3 |
Σημείο τήξης |
104℃ |
Σημείο βρασμού |
317.5°C at 760 mmHg |
Δείκτης διάθλασης |
1.627 |
Σημείο ανάφλεξης |
145.8°C |
Πίεση ατμών |
0.000384mmHg at 25°C |
Σύμβολα επικινδυνότητας |
Xn:Harmful;
|
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S36/37:Wear suitable protective clothing and gloves.;
|
|