ChemNet > CAS > 4653-08-1 3-(2-thenoyl)propionic acid
4653-08-1 3-(2-thenoyl)propionic acid
Ονομασία του προϊόντος |
3-(2-thenoyl)propionic acid |
Αγγλικό όνομα |
3-(2-thenoyl)propionic acid; 4-Oxo-4-(2-thienyl)butyric acid; 4-oxo-4-(thiophen-2-yl)butanoic acid; 4-oxo-4-thiophen-2-ylbutanoate |
MF |
C8H7O3S |
Μοριακό βάρος |
183.2049 |
InChI |
InChI=1/C8H8O3S/c9-6(3-4-8(10)11)7-2-1-5-12-7/h1-2,5H,3-4H2,(H,10,11)/p-1 |
CAS ΟΧΙ |
4653-08-1 |
EINECS |
225-089-5 |
Μοριακή δομή |
|
Σημείο βρασμού |
400.5°C at 760 mmHg |
Σημείο ανάφλεξης |
196°C |
Πίεση ατμών |
3.93E-07mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|