ChemNet > CAS > 4693-91-8 4-methoxyphenylacetyl chloride
4693-91-8 4-methoxyphenylacetyl chloride
| Ονομασία του προϊόντος |
4-methoxyphenylacetyl chloride |
| Αγγλικό όνομα |
4-methoxyphenylacetyl chloride; Benzenacetyl chloride, 4-methoxy-; (p-Methoxyphenyl)acetyl chloride; (4-Methoxyphenyl)acetylchloride |
| MF |
C9H9ClO2 |
| Μοριακό βάρος |
184.6196 |
| InChI |
InChI=1/C9H9ClO2/c1-12-8-4-2-7(3-5-8)6-9(10)11/h2-5H,6H2,1H3 |
| CAS ΟΧΙ |
4693-91-8 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.192g/cm3 |
| Σημείο βρασμού |
280.1°C at 760 mmHg |
| Δείκτης διάθλασης |
1.524 |
| Σημείο ανάφλεξης |
100°C |
| Πίεση ατμών |
0.00387mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
 C:Corrosive;
|
| Κινδύνου Κώδικες |
R34:Causes burns.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
