ChemNet > CAS > 4702-32-3 DL-Isocitric acid lactone
4702-32-3 DL-Isocitric acid lactone
Ονομασία του προϊόντος |
DL-Isocitric acid lactone |
Αγγλικό όνομα |
DL-Isocitric acid lactone; DL-2-Oxotetrahydrofuran-4,5-dicarboxylic acid; DL-Isocitriclactone; tetrahydro-5-oxofuran-2,3-dicarboxylic acid; 5-oxotetrahydrofuran-2,3-dicarboxylic acid (non-preferred name); (2S,3S)-5-oxotetrahydrofuran-2,3-dicarboxylic acid (non-preferred name); (2S,3R)-5-oxotetrahydrofuran-2,3-dicarboxylate (non-preferred name); (2R,3R)-5-oxotetrahydrofuran-2,3-dicarboxylate (non-preferred name); (2S,3S)-5-oxotetrahydrofuran-2,3-dicarboxylate (non-preferred name); (2R,3S)-5-oxotetrahydrofuran-2,3-dicarboxylate (non-preferred name) |
MF |
C6H4O6 |
Μοριακό βάρος |
172.0935 |
InChI |
InChI=1/C6H6O6/c7-3-1-2(5(8)9)4(12-3)6(10)11/h2,4H,1H2,(H,8,9)(H,10,11)/p-2/t2-,4+/m0/s1 |
CAS ΟΧΙ |
4702-32-3 |
EINECS |
225-178-9 |
Μοριακή δομή |
|
Σημείο τήξης |
158-164℃ |
Σημείο βρασμού |
586.8°C at 760 mmHg |
Σημείο ανάφλεξης |
253.3°C |
Πίεση ατμών |
2.74E-15mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|