ChemNet > CAS > 4707-47-5 Methyl-2,4-dihydroxy-3,6-dimethylbenzoate
4707-47-5 Methyl-2,4-dihydroxy-3,6-dimethylbenzoate
Ονομασία του προϊόντος |
Methyl-2,4-dihydroxy-3,6-dimethylbenzoate |
Αγγλικό όνομα |
Methyl-2,4-dihydroxy-3,6-dimethylbenzoate; |
MF |
C10H12O4 |
Μοριακό βάρος |
196.1999 |
InChI |
InChI=1/C10H12O4/c1-5-4-7(11)6(2)9(12)8(5)10(13)14-3/h4,11-12H,1-3H3 |
CAS ΟΧΙ |
4707-47-5 |
EINECS |
225-193-0 |
Μοριακή δομή |
|
Πυκνότητα |
1.251g/cm3 |
Σημείο βρασμού |
360.7°C at 760 mmHg |
Δείκτης διάθλασης |
1.57 |
Σημείο ανάφλεξης |
143.9°C |
Πίεση ατμών |
1.05E-05mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|