ChemNet > CAS > 4966-90-9 4-Hydroxy-6-methyl-3-nitro-2-pyridone
4966-90-9 4-Hydroxy-6-methyl-3-nitro-2-pyridone
| Ονομασία του προϊόντος |
4-Hydroxy-6-methyl-3-nitro-2-pyridone |
| Αγγλικό όνομα |
4-Hydroxy-6-methyl-3-nitro-2-pyridone; 2-hydroxy-6-methyl-3-nitropyridin-4(1H)-one |
| MF |
C6H6N2O4 |
| Μοριακό βάρος |
170.1228 |
| InChI |
InChI=1/C6H6N2O4/c1-3-2-4(9)5(8(11)12)6(10)7-3/h2H,1H3,(H2,7,9,10) |
| CAS ΟΧΙ |
4966-90-9 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.53g/cm3 |
| Σημείο τήξης |
293-296℃ |
| Σημείο βρασμού |
265.6°C at 760 mmHg |
| Δείκτης διάθλασης |
1.608 |
| Σημείο ανάφλεξης |
114.4°C |
| Πίεση ατμών |
0.00125mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
 Xi:Irritant;
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
