5144-10-5 Pentamethylbenzonitrile
Ονομασία του προϊόντος |
Pentamethylbenzonitrile |
Αγγλικό όνομα |
Pentamethylbenzonitrile; Penthamethylbenzonitrile |
MF |
C12H15N |
Μοριακό βάρος |
173.2542 |
InChI |
InChI=1/C12H15N/c1-7-8(2)10(4)12(6-13)11(5)9(7)3/h1-5H3 |
CAS ΟΧΙ |
5144-10-5 |
EINECS |
225-912-8 |
Μοριακή δομή |
|
Πυκνότητα |
0.96g/cm3 |
Σημείο τήξης |
158-160℃ |
Σημείο βρασμού |
313.2°C at 760 mmHg |
Δείκτης διάθλασης |
1.515 |
Σημείο ανάφλεξης |
143.8°C |
Πίεση ατμών |
0.000503mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R20/22:Harmful by inhalation and if swallowed.;
|
Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|