ChemNet > CAS > 51516-67-7 5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile
51516-67-7 5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile
Ονομασία του προϊόντος |
5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile |
Αγγλικό όνομα |
5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile; |
MF |
C10H7ClN4 |
Μοριακό βάρος |
218.6424 |
InChI |
InChI=1/C10H7ClN4/c11-8-1-3-9(4-2-8)15-10(13)7(5-12)6-14-15/h1-4,6H,13H2 |
CAS ΟΧΙ |
51516-67-7 |
Μοριακή δομή |
|
Πυκνότητα |
1.41g/cm3 |
Σημείο τήξης |
170℃ |
Σημείο βρασμού |
424.2°C at 760 mmHg |
Δείκτης διάθλασης |
1.686 |
Σημείο ανάφλεξης |
210.4°C |
Πίεση ατμών |
2.1E-07mmHg at 25°C |
Σύμβολα επικινδυνότητας |
Xn:Harmful;
|
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S36/37:Wear suitable protective clothing and gloves.;
|
|