ChemNet > CAS > 51605-97-1 4-Amino-2-bromocumene
51605-97-1 4-Amino-2-bromocumene
| Ονομασία του προϊόντος |
4-Amino-2-bromocumene |
| Αγγλικό όνομα |
4-Amino-2-bromocumene; 2-Bromo-4-isopropylaniline; 2-bromo-4-(propan-2-yl)aniline |
| MF |
C9H12BrN |
| Μοριακό βάρος |
214.1023 |
| InChI |
InChI=1/C9H12BrN/c1-6(2)7-3-4-9(11)8(10)5-7/h3-6H,11H2,1-2H3 |
| CAS ΟΧΙ |
51605-97-1 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.355g/cm3 |
| Σημείο βρασμού |
271.8°C at 760 mmHg |
| Δείκτης διάθλασης |
1.577 |
| Σημείο ανάφλεξης |
118.2°C |
| Πίεση ατμών |
0.00631mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S36/37:Wear suitable protective clothing and gloves.;
|
|
