ChemNet > CAS > 51639-48-6 4-Piperazinoacetophenone
51639-48-6 4-Piperazinoacetophenone
| Ονομασία του προϊόντος |
4-Piperazinoacetophenone |
| Αγγλικό όνομα |
4-Piperazinoacetophenone; piperazin-4-ylacetophenone; 1-[4-(piperazin-1-yl)phenyl]ethanone; 1-phenyl-2-piperazin-1-ylethanone; 4-(4-acetylphenyl)piperazin-1-ium; 4'-poperazinoacetophenone; 4'-Piperazinoacetophenone |
| MF |
C12H17N2O |
| Μοριακό βάρος |
205.2756 |
| InChI |
InChI=1/C12H16N2O/c1-10(15)11-2-4-12(5-3-11)14-8-6-13-7-9-14/h2-5,13H,6-9H2,1H3/p+1 |
| CAS ΟΧΙ |
51639-48-6 |
| EINECS |
257-332-6 |
| Μοριακή δομή |
|
| Σημείο τήξης |
107-112℃ |
| Σημείο βρασμού |
382.4°C at 760 mmHg |
| Σημείο ανάφλεξης |
185.1°C |
| Πίεση ατμών |
4.73E-06mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
 C:Corrosive;
|
| Κινδύνου Κώδικες |
R34:Causes burns.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
