ChemNet > CAS > 5253-02-1 alpha-ethyl-3-nitrocinnamic acid
5253-02-1 alpha-ethyl-3-nitrocinnamic acid
Ονομασία του προϊόντος |
alpha-ethyl-3-nitrocinnamic acid |
Αγγλικό όνομα |
alpha-ethyl-3-nitrocinnamic acid;alpha-Ethyl-3-nitrocinnamic acid; 2-(3-nitrobenzylidene)butanoic acid; (2Z)-2-[(3-nitrophenyl)methylidene]butanoic acid; (2E)-2-[(3-nitrophenyl)methylidene]butanoic acid |
MF |
C11H11NO4 |
Μοριακό βάρος |
221.2093 |
InChI |
InChI=1/C11H11NO4/c1-2-9(11(13)14)6-8-4-3-5-10(7-8)12(15)16/h3-7H,2H2,1H3,(H,13,14)/b9-6+ |
CAS ΟΧΙ |
5253-02-1 |
EINECS |
226-054-7 |
Μοριακή δομή |
|
Πυκνότητα |
1.303g/cm3 |
Σημείο βρασμού |
381.3°C at 760 mmHg |
Δείκτης διάθλασης |
1.616 |
Σημείο ανάφλεξης |
164.2°C |
Πίεση ατμών |
1.71E-06mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|