ChemNet > CAS > 5422-88-8 Cyclopentyl phenyl ketone
5422-88-8 Cyclopentyl phenyl ketone
| Ονομασία του προϊόντος |
Cyclopentyl phenyl ketone |
| Αγγλικό όνομα |
Cyclopentyl phenyl ketone; Benzoylcyclopentane; cyclopentyl(phenyl)methanone |
| MF |
C12H14O |
| Μοριακό βάρος |
174.239 |
| InChI |
InChI=1/C12H14O/c13-12(11-8-4-5-9-11)10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2 |
| CAS ΟΧΙ |
5422-88-8 |
| EINECS |
226-548-2 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.051g/cm3 |
| Σημείο βρασμού |
273.9°C at 760 mmHg |
| Δείκτης διάθλασης |
1.548 |
| Σημείο ανάφλεξης |
112.4°C |
| Πίεση ατμών |
0.00556mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|
