ChemNet > CAS > 55776-17-5 2,6-Dimethoxy-3-nitrobenzoic acid
55776-17-5 2,6-Dimethoxy-3-nitrobenzoic acid
| Ονομασία του προϊόντος |
2,6-Dimethoxy-3-nitrobenzoic acid |
| Αγγλικό όνομα |
2,6-Dimethoxy-3-nitrobenzoic acid; |
| MF |
C9H9NO6 |
| Μοριακό βάρος |
227.1709 |
| InChI |
InChI=1/C9H9NO6/c1-15-6-4-3-5(10(13)14)8(16-2)7(6)9(11)12/h3-4H,1-2H3,(H,11,12) |
| CAS ΟΧΙ |
55776-17-5 |
| EINECS |
259-814-1 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.403g/cm3 |
| Σημείο βρασμού |
420.7°C at 760 mmHg |
| Δείκτης διάθλασης |
1.569 |
| Σημείο ανάφλεξης |
208.2°C |
| Πίεση ατμών |
7.92E-08mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
