570-08-1 Diethyl acetylmalonate

Ονομασία του προϊόντος	Diethyl acetylmalonate
Αγγλικό όνομα	Diethyl acetylmalonate; Acetylmalonic acid diethyl ester; (2-ethylbutanoyl)propanedioate
MF	C₉H₁₂O₅
Μοριακό βάρος	200.1897
InChI	InChI=1/C9H14O5/c1-3-5(4-2)7(10)6(8(11)12)9(13)14/h5-6H,3-4H2,1-2H3,(H,11,12)(H,13,14)/p-2
CAS ΟΧΙ	570-08-1
Μοριακή δομή
Σημείο βρασμού	372.3°C at 760 mmHg
Σημείο ανάφλεξης	193.1°C
Πίεση ατμών	1.45E-06mmHg at 25°C
Σύμβολα επικινδυνότητας
Κινδύνου Κώδικες	R36/38:Irritating to eyes and skin.;
Περιγραφή της ασφάλειας	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;