Ονομασία του προϊόντος |
bis(2-hydroxyethyl)ammonium 2,4-dichlorophenoxyacetate |
Αγγλικό όνομα |
bis(2-hydroxyethyl)ammonium 2,4-dichlorophenoxyacetate;2,4-D-diolamine [ISO]; 2,4-D Bis(2-hydroxyethyl)ammonium; 2,4-D Diethanolamine salt; 2,4-D-Bis(2-hydroxyethyl)ammonium; 2,4-D-diolamine; 2,4-Dichlorophenoxyacetic acid diethanolamine salt; CCRIS 8564; Caswell No. 315K; EPA Pesticide Chemical Code 030016; Acetic acid, (2,4-dichlorophenoxy)-, compd. with 2,2'-iminobis(ethanol) (1:1); Acetic acid, (2,4-dichlorophenoxy)-, diethanolamine salt; Bis(2-hydroxyethyl)ammonium 2,4-dichlorophenoxyacetate; Diethanolamine 2,4-dichlorophenoxyacetate; Diethanolamine salt of 2,4-dichlorophenoxyacetic acid solution; (2,4-dichlorophenoxy)acetic acid - 2,2'-iminodiethanol (1:1) |
MF |
C12H17Cl2NO5 |
Μοριακό βάρος |
326.1731 |
InChI |
InChI=1/C8H6Cl2O3.C4H11NO2/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;6-3-1-5-2-4-7/h1-3H,4H2,(H,11,12);5-7H,1-4H2 |
CAS ΟΧΙ |
5742-19-8 |
EINECS |
227-256-8 |
Μοριακή δομή |
|
Σημείο βρασμού |
345.6°C at 760 mmHg |
Σημείο ανάφλεξης |
162.8°C |
Πίεση ατμών |
2.31E-05mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
|
|