ChemNet > CAS > 579-49-7 (4-Fluorophenyl)-(2-thienyl) ketone
579-49-7 (4-Fluorophenyl)-(2-thienyl) ketone
| Ονομασία του προϊόντος |
(4-Fluorophenyl)-(2-thienyl) ketone |
| Αγγλικό όνομα |
(4-Fluorophenyl)-(2-thienyl) ketone; (4-Fluorophenyl)-2-thienyl methanone; 4-Fluorophenyl-2-thienyl ketone; (4-fluorophenyl)(thiophen-2-yl)methanone |
| MF |
C11H7FOS |
| Μοριακό βάρος |
206.2361 |
| InChI |
InChI=1/C11H7FOS/c12-9-5-3-8(4-6-9)11(13)10-2-1-7-14-10/h1-7H |
| CAS ΟΧΙ |
579-49-7 |
| EINECS |
209-442-0 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.279g/cm3 |
| Σημείο τήξης |
94-99℃ |
| Σημείο βρασμού |
314.7°C at 760 mmHg |
| Δείκτης διάθλασης |
1.59 |
| Σημείο ανάφλεξης |
144.1°C |
| Πίεση ατμών |
0.000459mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|
