588-43-2 tributyl orthoformate
Ονομασία του προϊόντος |
tributyl orthoformate |
Αγγλικό όνομα |
tributyl orthoformate; 1-(Dibutoxymethoxy)butane; 1,1',1''-(Methylidynetris(oxy))tributane; Butane, 1,1',1''-(methylidynetris(oxy))tris-; butane, 1,1',1''-[methylidynetris(oxy)]tris-; Orthoformic acid, tributyl ester; Orthoformic acid, tributyl ester (8CI) |
MF |
C13H28O3 |
Μοριακό βάρος |
232.3596 |
InChI |
InChI=1/C13H28O3/c1-4-7-10-14-13(15-11-8-5-2)16-12-9-6-3/h13H,4-12H2,1-3H3 |
CAS ΟΧΙ |
588-43-2 |
EINECS |
209-618-7 |
Μοριακή δομή |
|
Πυκνότητα |
0.884g/cm3 |
Σημείο βρασμού |
262.7°C at 760 mmHg |
Δείκτης διάθλασης |
1.427 |
Σημείο ανάφλεξης |
96.3°C |
Πίεση ατμών |
0.0175mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|