ChemNet > CAS > 589-91-3 4-Methylcyclohexanol, mixture of cis and trans
589-91-3 4-Methylcyclohexanol, mixture of cis and trans
| Ονομασία του προϊόντος |
4-Methylcyclohexanol, mixture of cis and trans |
| Αγγλικό όνομα |
4-Methylcyclohexanol, mixture of cis and trans; 4-Methylcyclohexanol (cis+trans); 4-Methylcyclohexanol; trans-4-methylcyclohexanol; Methyl cyclohexanol |
| MF |
C7H14O |
| Μοριακό βάρος |
114.1855 |
| InChI |
InChI=1/C7H14O/c1-6-2-4-7(8)5-3-6/h6-8H,2-5H2,1H3/t6-,7- |
| CAS ΟΧΙ |
589-91-3 |
| EINECS |
209-664-8 |
| Μοριακή δομή |
|
| Πυκνότητα |
0.925g/cm3 |
| Σημείο τήξης |
-41℃ |
| Σημείο βρασμού |
170.322°C at 760 mmHg |
| Δείκτης διάθλασης |
1.463 |
| Σημείο ανάφλεξης |
70°C |
| Υδατοδιαλυτότητα |
slightly soluble |
| Πίεση ατμών |
0.475mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
S24/25:;
|
|
