ChemNet > CAS > 5905-69-1 4-(difluoromethoxy)bromobenzene
5905-69-1 4-(difluoromethoxy)bromobenzene
| Ονομασία του προϊόντος |
4-(difluoromethoxy)bromobenzene |
| Αγγλικό όνομα |
4-(difluoromethoxy)bromobenzene; 1-Bromo-4-(difluoromethoxy)benzene; p-Difluoromethoxybromobenzene |
| MF |
C7H5BrF2O |
| Μοριακό βάρος |
223.0148 |
| InChI |
InChI=1/C7H5BrF2O/c8-5-1-3-6(4-2-5)11-7(9)10/h1-4,7H |
| CAS ΟΧΙ |
5905-69-1 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.583g/cm3 |
| Σημείο βρασμού |
205.406°C at 760 mmHg |
| Δείκτης διάθλασης |
1.492 |
| Σημείο ανάφλεξης |
92.591°C |
| Πίεση ατμών |
0.359mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
 Xi:Irritant;
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
