ChemNet > CAS > 610-16-2 2-Dimethylaminobenzoic acid
610-16-2 2-Dimethylaminobenzoic acid
| Ονομασία του προϊόντος |
2-Dimethylaminobenzoic acid |
| Αγγλικό όνομα |
2-Dimethylaminobenzoic acid;Benzoic acid, 2-(dimethylamino)-; 2-(Dimethylamino)benzoic acid; AI3-05925; N,N-Dimethylanthranilic acid; NSC 45790; Anthranilic acid, N,N-dimethyl- (8CI); 2-(dimethylamino)benzoate |
| MF |
C9H10NO2 |
| Μοριακό βάρος |
164.1817 |
| InChI |
InChI=1/C9H11NO2/c1-10(2)8-6-4-3-5-7(8)9(11)12/h3-6H,1-2H3,(H,11,12)/p-1 |
| CAS ΟΧΙ |
610-16-2 |
| EINECS |
210-209-0 |
| Μοριακή δομή |
|
| Σημείο τήξης |
71-72℃ |
| Σημείο βρασμού |
288.5°C at 760 mmHg |
| Σημείο ανάφλεξης |
128.3°C |
| Πίεση ατμών |
0.00108mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
