ChemNet > CAS > 622-93-5 3-Diethylamino-1-propanol
622-93-5 3-Diethylamino-1-propanol
| Ονομασία του προϊόντος |
3-Diethylamino-1-propanol |
| Αγγλικό όνομα |
3-Diethylamino-1-propanol; |
| MF |
C7H18NO |
| Μοριακό βάρος |
132.2234 |
| InChI |
InChI=1/C7H17NO/c1-3-8(4-2)6-5-7-9/h9H,3-7H2,1-2H3/p+1 |
| CAS ΟΧΙ |
622-93-5 |
| EINECS |
210-759-1 |
| Μοριακή δομή |
|
| Σημείο βρασμού |
189.5°C at 760 mmHg |
| Σημείο ανάφλεξης |
65.6°C |
| Πίεση ατμών |
0.155mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
 Xi:Irritant;
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S7:Keep container tightly closed.;
|
|
