ChemNet > CAS > 624-39-5 1,4-Benzenedithiol
624-39-5 1,4-Benzenedithiol
Ονομασία του προϊόντος |
1,4-Benzenedithiol |
Αγγλικό όνομα |
1,4-Benzenedithiol; 1,4-Dimercaptobenzene; Dithiohydroquinone; benzene-1,4-dithiol; benzene-1,4-bis(thiolate) |
MF |
C6H4S2 |
Μοριακό βάρος |
140.2271 |
InChI |
InChI=1/C6H6S2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H/p-2 |
CAS ΟΧΙ |
624-39-5 |
Μοριακή δομή |
|
Σημείο βρασμού |
243.3°C at 760 mmHg |
Σημείο ανάφλεξης |
111.8°C |
Πίεση ατμών |
0.0506mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|