ChemNet > CAS > 627-95-2 5-Aminovaleric acid hydrochloride
627-95-2 5-Aminovaleric acid hydrochloride
| Ονομασία του προϊόντος |
5-Aminovaleric acid hydrochloride |
| Αγγλικό όνομα |
5-Aminovaleric acid hydrochloride; 4-carboxybutylammonium chloride; 5-Aminopentanoic acid hydrochloride; 5-aminopentanoic acid; 5-aminopentanoic acid hydrochloride (1:1) |
| MF |
C5H12ClNO2 |
| Μοριακό βάρος |
153.6073 |
| InChI |
InChI=1/C5H11NO2.ClH/c6-4-2-1-3-5(7)8;/h1-4,6H2,(H,7,8);1H |
| CAS ΟΧΙ |
627-95-2 |
| EINECS |
211-021-1 |
| Μοριακή δομή |
|
| Σημείο τήξης |
95-99℃ |
| Σημείο βρασμού |
247.5°C at 760 mmHg |
| Σημείο ανάφλεξης |
103.5°C |
| Πίεση ατμών |
0.00825mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|
